C21H22F3N3OS — CID 78879719
1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea (PubChem CID 78879719) has the molecular formula C21H22F3N3OS and a molecular weight of 421.49 g/mol. Its IUPAC name is 1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea.
| Compound Name | 1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
|---|---|
| PubChem CID | 78879719 |
| Molecular Formula | C21H22F3N3OS |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 1-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]urea |
| SMILES | O=C(NCC#Cc1cccc(C(F)(F)F)c1)NCC(c1cccs1)N1CCCC1 |
| InChI | InChI=1S/C21H22F3N3OS/c22-21(23,24)17-8-3-6-16(14-17)7-4-10-25-20(28)26-15-18(19-9-5-13-29-19)27-11-1-2-12-27/h3,5-6,8-9,13-14,18H,1-2,10-12,15H2,(H2,25,26,28) |
| InChIKey | HEFMTMQSKNFSGC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|