C18H18O4S — CID 78889042
2,3-dihydro-1,4-benzodioxin-6-yl 2-benzylsulfanylpropanoate (PubChem CID 78889042) has the molecular formula C18H18O4S and a molecular weight of 330.40 g/mol. Its IUPAC name is 2,3-dihydro-1,4-benzodioxin-6-yl 2-benzylsulfanylpropanoate.
| Compound Name | 2,3-dihydro-1,4-benzodioxin-6-yl 2-benzylsulfanylpropanoate |
|---|---|
| PubChem CID | 78889042 |
| Molecular Formula | C18H18O4S |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 2,3-dihydro-1,4-benzodioxin-6-yl 2-benzylsulfanylpropanoate |
| SMILES | CC(SCc1ccccc1)C(=O)Oc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C18H18O4S/c1-13(23-12-14-5-3-2-4-6-14)18(19)22-15-7-8-16-17(11-15)21-10-9-20-16/h2-8,11,13H,9-10,12H2,1H3 |
| InChIKey | JFYZUNGHSUHDOS-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|