C14H13ClF3N3OS — CID 78890013
N-[(5-chlorothiophen-2-yl)methyl]-1-methyl-N-prop-2-enyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 78890013) has the molecular formula C14H13ClF3N3OS and a molecular weight of 363.79 g/mol. Its IUPAC name is N-[(5-chlorothiophen-2-yl)methyl]-1-methyl-N-prop-2-enyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[(5-chlorothiophen-2-yl)methyl]-1-methyl-N-prop-2-enyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 78890013 |
| Molecular Formula | C14H13ClF3N3OS |
| Molecular Weight | 363.79 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | N-[(5-chlorothiophen-2-yl)methyl]-1-methyl-N-prop-2-enyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | C=CCN(Cc1ccc(Cl)s1)C(=O)c1cn(C)nc1C(F)(F)F |
| InChI | InChI=1S/C14H13ClF3N3OS/c1-3-6-21(7-9-4-5-11(15)23-9)13(22)10-8-20(2)19-12(10)14(16,17)18/h3-5,8H,1,6-7H2,2H3 |
| InChIKey | KSFPNVMFTOQOPY-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.79 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|