C8H4ClNOS2 — CID 78923566
(5-chlorothiophen-2-yl)-(1,3-thiazol-4-yl)methanone (PubChem CID 78923566) has the molecular formula C8H4ClNOS2 and a molecular weight of 229.71 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)-(1,3-thiazol-4-yl)methanone.
| Compound Name | (5-chlorothiophen-2-yl)-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 78923566 |
| Molecular Formula | C8H4ClNOS2 |
| Molecular Weight | 229.71 g/mol |
| Exact Mass | 228.94 |
| IUPAC Name | (5-chlorothiophen-2-yl)-(1,3-thiazol-4-yl)methanone |
| SMILES | O=C(c1cscn1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C8H4ClNOS2/c9-7-2-1-6(13-7)8(11)5-3-12-4-10-5/h1-4H |
| InChIKey | LOKLKDCRUMCDMB-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |