C14H14N4O2 — CID 79192298
4-(3-quinoxalin-6-yl-1,2,4-oxadiazol-5-yl)butan-1-ol (PubChem CID 79192298) has the molecular formula C14H14N4O2 and a molecular weight of 270.29 g/mol. Its IUPAC name is 4-(3-quinoxalin-6-yl-1,2,4-oxadiazol-5-yl)butan-1-ol.
| Compound Name | 4-(3-quinoxalin-6-yl-1,2,4-oxadiazol-5-yl)butan-1-ol |
|---|---|
| PubChem CID | 79192298 |
| Molecular Formula | C14H14N4O2 |
| Molecular Weight | 270.29 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 4-(3-quinoxalin-6-yl-1,2,4-oxadiazol-5-yl)butan-1-ol |
| SMILES | OCCCCc1nc(-c2ccc3nccnc3c2)no1 |
| InChI | InChI=1S/C14H14N4O2/c19-8-2-1-3-13-17-14(18-20-13)10-4-5-11-12(9-10)16-7-6-15-11/h4-7,9,19H,1-3,8H2 |
| InChIKey | RFRXVKLLYOVBEV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 84.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.29 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|