C12H18N4OS — CID 79242441
4-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 79242441) has the molecular formula C12H18N4OS and a molecular weight of 266.37 g/mol. Its IUPAC name is 4-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-propyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-propyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 79242441 |
| Molecular Formula | C12H18N4OS |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 4-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-3-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCc1n[nH]c(=S)n1C(C)c1c(C)noc1C |
| InChI | InChI=1S/C12H18N4OS/c1-5-6-10-13-14-12(18)16(10)8(3)11-7(2)15-17-9(11)4/h8H,5-6H2,1-4H3,(H,14,18) |
| InChIKey | GSEIDAQUVKAJBB-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|