C11H19N3OS — CID 47950224
1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea (PubChem CID 47950224) has the molecular formula C11H19N3OS and a molecular weight of 241.36 g/mol. Its IUPAC name is 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea.
| Compound Name | 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea |
|---|---|
| PubChem CID | 47950224 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea |
| SMILES | CCCCNC(=S)NCc1c(C)noc1C |
| InChI | InChI=1S/C11H19N3OS/c1-4-5-6-12-11(16)13-7-10-8(2)14-15-9(10)3/h4-7H2,1-3H3,(H2,12,13,16) |
| InChIKey | AMJDCSYIMMKDLE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|