About 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea
1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea (PubChem CID 47950224) has the molecular formula C11H19N3OS
and a molecular weight of 241.36 g/mol. Its IUPAC name is 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea.
Molecular Properties
| Compound Name | 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea |
| PubChem CID | 47950224 |
| Molecular Formula | C11H19N3OS |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea |
| SMILES | CCCCNC(=S)NCc1c(C)noc1C |
| InChI | InChI=1S/C11H19N3OS/c1-4-5-6-12-11(16)13-7-10-8(2)14-15-9(10)3/h4-7H2,1-3H3,(H2,12,13,16) |
| InChIKey | AMJDCSYIMMKDLE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea?
The IUPAC name of 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea (CID 47950224) is 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea.
What is the SMILES notation for 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea?
The canonical SMILES for 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea is CCCCNC(=S)NCc1c(C)noc1C.
What is the InChIKey of 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea?
The InChIKey is AMJDCSYIMMKDLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N3OS/c1-4-5-6-12-11(16)13-7-10-8(2)14-15-9(10)3/h4-7H2,1-3H3,(H2,12,13,16).
What are the key properties of 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea?
1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea has a molecular weight of 241.36 g/mol, XLogP of 2.06, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]thiourea is sourced from PubChem (CID 47950224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).