About 1-methoxypropan-2-yl 5-amino-3-methyl-1,2-thiazole-4-carboxylate
1-methoxypropan-2-yl 5-amino-3-methyl-1,2-thiazole-4-carboxylate (PubChem CID 79391779) has the molecular formula C9H14N2O3S
and a molecular weight of 230.29 g/mol. Its IUPAC name is 1-methoxypropan-2-yl 5-amino-3-methyl-1,2-thiazole-4-carboxylate.
Analyze 1-methoxypropan-2-yl 5-amino-3-methyl-1,2-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-yl 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The IUPAC name of 1-methoxypropan-2-yl 5-amino-3-methyl-1,2-thiazole-4-carboxylate (CID 79391779) is 1-methoxypropan-2-yl 5-amino-3-methyl-1,2-thiazole-4-carboxylate.
What is the SMILES notation for 1-methoxypropan-2-yl 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The canonical SMILES for 1-methoxypropan-2-yl 5-amino-3-methyl-1,2-thiazole-4-carboxylate is COCC(C)OC(=O)c1c(C)nsc1N.
What is the InChIKey of 1-methoxypropan-2-yl 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
The InChIKey is CWMXSLKAOBEOLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O3S/c1-5(4-13-3)14-9(12)7-6(2)11-15-8(7)10/h5H,4,10H2,1-3H3.
What are the key properties of 1-methoxypropan-2-yl 5-amino-3-methyl-1,2-thiazole-4-carboxylate?
1-methoxypropan-2-yl 5-amino-3-methyl-1,2-thiazole-4-carboxylate has a molecular weight of 230.29 g/mol, XLogP of 1.23, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-yl 5-amino-3-methyl-1,2-thiazole-4-carboxylate is sourced from PubChem (CID 79391779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).