C11H13Br2NO2S — CID 79416082
2-(2,5-dibromo-4-methoxyphenoxy)butanethioamide (PubChem CID 79416082) has the molecular formula C11H13Br2NO2S and a molecular weight of 383.11 g/mol. Its IUPAC name is 2-(2,5-dibromo-4-methoxyphenoxy)butanethioamide.
| Compound Name | 2-(2,5-dibromo-4-methoxyphenoxy)butanethioamide |
|---|---|
| PubChem CID | 79416082 |
| Molecular Formula | C11H13Br2NO2S |
| Molecular Weight | 383.11 g/mol |
| Exact Mass | 380.90 |
| IUPAC Name | 2-(2,5-dibromo-4-methoxyphenoxy)butanethioamide |
| SMILES | CCC(Oc1cc(Br)c(OC)cc1Br)C(N)=S |
| InChI | InChI=1S/C11H13Br2NO2S/c1-3-8(11(14)17)16-10-5-6(12)9(15-2)4-7(10)13/h4-5,8H,3H2,1-2H3,(H2,14,17) |
| InChIKey | BCGLHHYBXGKCIP-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.11 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|