C10H6Br2O3 — CID 79416402
4,7-dibromo-5-methoxy-1-benzofuran-2-carbaldehyde (PubChem CID 79416402) has the molecular formula C10H6Br2O3 and a molecular weight of 333.96 g/mol. Its IUPAC name is 4,7-dibromo-5-methoxy-1-benzofuran-2-carbaldehyde.
| Compound Name | 4,7-dibromo-5-methoxy-1-benzofuran-2-carbaldehyde |
|---|---|
| PubChem CID | 79416402 |
| Molecular Formula | C10H6Br2O3 |
| Molecular Weight | 333.96 g/mol |
| Exact Mass | 331.87 |
| IUPAC Name | 4,7-dibromo-5-methoxy-1-benzofuran-2-carbaldehyde |
| SMILES | COc1cc(Br)c2oc(C=O)cc2c1Br |
| InChI | InChI=1S/C10H6Br2O3/c1-14-8-3-7(11)10-6(9(8)12)2-5(4-13)15-10/h2-4H,1H3 |
| InChIKey | LIPARAYTTCVVAA-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.96 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|