C12H9BrO3S — CID 79595048
1,3-benzodioxol-5-yl-(4-bromothiophen-3-yl)methanol (PubChem CID 79595048) has the molecular formula C12H9BrO3S and a molecular weight of 313.17 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-(4-bromothiophen-3-yl)methanol.
| Compound Name | 1,3-benzodioxol-5-yl-(4-bromothiophen-3-yl)methanol |
|---|---|
| PubChem CID | 79595048 |
| Molecular Formula | C12H9BrO3S |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 1,3-benzodioxol-5-yl-(4-bromothiophen-3-yl)methanol |
| SMILES | OC(c1ccc2c(c1)OCO2)c1cscc1Br |
| InChI | InChI=1S/C12H9BrO3S/c13-9-5-17-4-8(9)12(14)7-1-2-10-11(3-7)16-6-15-10/h1-5,12,14H,6H2 |
| InChIKey | VTDGTHOPEXMOSU-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |