C21H20Cl2N2O3 — CID 7959542
(3,4-dichlorophenyl) 3-hexyl-4-oxophthalazine-1-carboxylate (PubChem CID 7959542) has the molecular formula C21H20Cl2N2O3 and a molecular weight of 419.31 g/mol. Its IUPAC name is (3,4-dichlorophenyl) 3-hexyl-4-oxophthalazine-1-carboxylate.
| Compound Name | (3,4-dichlorophenyl) 3-hexyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 7959542 |
| Molecular Formula | C21H20Cl2N2O3 |
| Molecular Weight | 419.31 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | (3,4-dichlorophenyl) 3-hexyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCCCCCn1nc(C(=O)Oc2ccc(Cl)c(Cl)c2)c2ccccc2c1=O |
| InChI | InChI=1S/C21H20Cl2N2O3/c1-2-3-4-7-12-25-20(26)16-9-6-5-8-15(16)19(24-25)21(27)28-14-10-11-17(22)18(23)13-14/h5-6,8-11,13H,2-4,7,12H2,1H3 |
| InChIKey | VQVQKPUQAVQOTG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.31 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|