C22H22N2O5 — CID 8766410
1,3-benzodioxol-5-yl 3-hexyl-4-oxophthalazine-1-carboxylate (PubChem CID 8766410) has the molecular formula C22H22N2O5 and a molecular weight of 394.43 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 3-hexyl-4-oxophthalazine-1-carboxylate.
| Compound Name | 1,3-benzodioxol-5-yl 3-hexyl-4-oxophthalazine-1-carboxylate |
|---|---|
| PubChem CID | 8766410 |
| Molecular Formula | C22H22N2O5 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.15 |
| IUPAC Name | 1,3-benzodioxol-5-yl 3-hexyl-4-oxophthalazine-1-carboxylate |
| SMILES | CCCCCCn1nc(C(=O)Oc2ccc3c(c2)OCO3)c2ccccc2c1=O |
| InChI | InChI=1S/C22H22N2O5/c1-2-3-4-7-12-24-21(25)17-9-6-5-8-16(17)20(23-24)22(26)29-15-10-11-18-19(13-15)28-14-27-18/h5-6,8-11,13H,2-4,7,12,14H2,1H3 |
| InChIKey | HNGGICYYUILBHU-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 79.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|