C7H12N2O5S — CID 79672984
(2S)-4-amino-4-oxo-2-(prop-2-enylsulfonylamino)butanoic acid (PubChem CID 79672984) has the molecular formula C7H12N2O5S and a molecular weight of 236.25 g/mol. Its IUPAC name is (2S)-4-amino-4-oxo-2-(prop-2-enylsulfonylamino)butanoic acid.
| Compound Name | (2S)-4-amino-4-oxo-2-(prop-2-enylsulfonylamino)butanoic acid |
|---|---|
| PubChem CID | 79672984 |
| Molecular Formula | C7H12N2O5S |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | (2S)-4-amino-4-oxo-2-(prop-2-enylsulfonylamino)butanoic acid |
| SMILES | C=CCS(=O)(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C7H12N2O5S/c1-2-3-15(13,14)9-5(7(11)12)4-6(8)10/h2,5,9H,1,3-4H2,(H2,8,10)(H,11,12)/t5-/m0/s1 |
| InChIKey | SRQZJZGYTXBTAY-YFKPBYRVSA-N |
| XLogP | -1.58 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|