C6H14N2O3S — CID 79682607
2-(2,3-dihydroxypropylsulfanyl)-N'-hydroxypropanimidamide (PubChem CID 79682607) has the molecular formula C6H14N2O3S and a molecular weight of 194.26 g/mol. Its IUPAC name is 2-(2,3-dihydroxypropylsulfanyl)-N'-hydroxypropanimidamide.
| Compound Name | 2-(2,3-dihydroxypropylsulfanyl)-N'-hydroxypropanimidamide |
|---|---|
| PubChem CID | 79682607 |
| Molecular Formula | C6H14N2O3S |
| Molecular Weight | 194.26 g/mol |
| Exact Mass | 194.07 |
| IUPAC Name | 2-(2,3-dihydroxypropylsulfanyl)-N'-hydroxypropanimidamide |
| SMILES | CC(SCC(O)CO)C(N)=NO |
| InChI | InChI=1S/C6H14N2O3S/c1-4(6(7)8-11)12-3-5(10)2-9/h4-5,9-11H,2-3H2,1H3,(H2,7,8) |
| InChIKey | KJLZVPBCIJYLRB-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.26 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|