C14H18N6 — CID 79740503
2-N,2-N-dimethyl-6-(5,6,7,8-tetrahydroquinolin-8-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 79740503) has the molecular formula C14H18N6 and a molecular weight of 270.34 g/mol. Its IUPAC name is 2-N,2-N-dimethyl-6-(5,6,7,8-tetrahydroquinolin-8-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N,2-N-dimethyl-6-(5,6,7,8-tetrahydroquinolin-8-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 79740503 |
| Molecular Formula | C14H18N6 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | 2-N,2-N-dimethyl-6-(5,6,7,8-tetrahydroquinolin-8-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | CN(C)c1nc(N)nc(C2CCCc3cccnc32)n1 |
| InChI | InChI=1S/C14H18N6/c1-20(2)14-18-12(17-13(15)19-14)10-7-3-5-9-6-4-8-16-11(9)10/h4,6,8,10H,3,5,7H2,1-2H3,(H2,15,17,18,19) |
| InChIKey | QUFLPVLCHUKCAT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 80.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |