C11H10N4OS2 — CID 79765066
[5-(1,3-benzoxazol-2-ylsulfanylmethyl)-1,3-thiazol-2-yl]hydrazine (PubChem CID 79765066) has the molecular formula C11H10N4OS2 and a molecular weight of 278.36 g/mol. Its IUPAC name is [5-(1,3-benzoxazol-2-ylsulfanylmethyl)-1,3-thiazol-2-yl]hydrazine.
| Compound Name | [5-(1,3-benzoxazol-2-ylsulfanylmethyl)-1,3-thiazol-2-yl]hydrazine |
|---|---|
| PubChem CID | 79765066 |
| Molecular Formula | C11H10N4OS2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.03 |
| IUPAC Name | [5-(1,3-benzoxazol-2-ylsulfanylmethyl)-1,3-thiazol-2-yl]hydrazine |
| SMILES | NNc1ncc(CSc2nc3ccccc3o2)s1 |
| InChI | InChI=1S/C11H10N4OS2/c12-15-10-13-5-7(18-10)6-17-11-14-8-3-1-2-4-9(8)16-11/h1-5H,6,12H2,(H,13,15) |
| InChIKey | ZMTYJAXQRNMEQG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|