C12H15N3O — CID 79961241
5-amino-4-(2,3-dimethylphenyl)-3-methyl-4H-imidazol-2-one (PubChem CID 79961241) has the molecular formula C12H15N3O and a molecular weight of 217.27 g/mol. Its IUPAC name is 5-amino-4-(2,3-dimethylphenyl)-3-methyl-4H-imidazol-2-one.
| Compound Name | 5-amino-4-(2,3-dimethylphenyl)-3-methyl-4H-imidazol-2-one |
|---|---|
| PubChem CID | 79961241 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 5-amino-4-(2,3-dimethylphenyl)-3-methyl-4H-imidazol-2-one |
| SMILES | Cc1cccc(C2C(N)=NC(=O)N2C)c1C |
| InChI | InChI=1S/C12H15N3O/c1-7-5-4-6-9(8(7)2)10-11(13)14-12(16)15(10)3/h4-6,10H,1-3H3,(H2,13,14,16) |
| InChIKey | GPPPIHCWVQUXGQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |