C15H22N4O — CID 80862063
8-(3,3,5-trimethylcyclohexyl)oxyimidazo[1,2-a]pyrazin-6-amine (PubChem CID 80862063) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is 8-(3,3,5-trimethylcyclohexyl)oxyimidazo[1,2-a]pyrazin-6-amine.
| Compound Name | 8-(3,3,5-trimethylcyclohexyl)oxyimidazo[1,2-a]pyrazin-6-amine |
|---|---|
| PubChem CID | 80862063 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | 8-(3,3,5-trimethylcyclohexyl)oxyimidazo[1,2-a]pyrazin-6-amine |
| SMILES | CC1CC(Oc2nc(N)cn3ccnc23)CC(C)(C)C1 |
| InChI | InChI=1S/C15H22N4O/c1-10-6-11(8-15(2,3)7-10)20-14-13-17-4-5-19(13)9-12(16)18-14/h4-5,9-11H,6-8,16H2,1-3H3 |
| InChIKey | RIOWVIGDLOIPON-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 65.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |