C14H16N2O3S — CID 80996895
2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]cyclobutane-1-carboxylic acid (PubChem CID 80996895) has the molecular formula C14H16N2O3S and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 80996895 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-[(6-ethoxy-1H-benzimidazol-2-yl)sulfanyl]cyclobutane-1-carboxylic acid |
| SMILES | CCOc1ccc2nc(SC3CCC3C(=O)O)[nH]c2c1 |
| InChI | InChI=1S/C14H16N2O3S/c1-2-19-8-3-5-10-11(7-8)16-14(15-10)20-12-6-4-9(12)13(17)18/h3,5,7,9,12H,2,4,6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | XOPPGFAOROIKIN-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |