C9H20N2O3S — CID 81173878
2-(2-aminoethylsulfonyl)-N,N-diethylpropanamide (PubChem CID 81173878) has the molecular formula C9H20N2O3S and a molecular weight of 236.34 g/mol. Its IUPAC name is 2-(2-aminoethylsulfonyl)-N,N-diethylpropanamide.
| Compound Name | 2-(2-aminoethylsulfonyl)-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 81173878 |
| Molecular Formula | C9H20N2O3S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2-(2-aminoethylsulfonyl)-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)S(=O)(=O)CCN |
| InChI | InChI=1S/C9H20N2O3S/c1-4-11(5-2)9(12)8(3)15(13,14)7-6-10/h8H,4-7,10H2,1-3H3 |
| InChIKey | WJQYGGVGKOYXKM-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |