C12H14ClNO2 — CID 81429784
N-[(E)-4-chlorobut-2-enyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 81429784) has the molecular formula C12H14ClNO2 and a molecular weight of 239.70 g/mol. Its IUPAC name is N-[(E)-4-chlorobut-2-enyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[(E)-4-chlorobut-2-enyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 81429784 |
| Molecular Formula | C12H14ClNO2 |
| Molecular Weight | 239.70 g/mol |
| Exact Mass | 239.07 |
| IUPAC Name | N-[(E)-4-chlorobut-2-enyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | ClC/C=C/CNc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C12H14ClNO2/c13-5-1-2-6-14-10-3-4-11-12(9-10)16-8-7-15-11/h1-4,9,14H,5-8H2/b2-1+ |
| InChIKey | XYYQBFJGCMMLMR-OWOJBTEDSA-N |
| XLogP | 2.66 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.70 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|