C13H12ClN3O4S — CID 82162000
3-[2-(4-chloro-3-nitroanilino)-4-methyl-1,3-thiazol-5-yl]propanoic acid (PubChem CID 82162000) has the molecular formula C13H12ClN3O4S and a molecular weight of 341.78 g/mol. Its IUPAC name is 3-[2-(4-chloro-3-nitroanilino)-4-methyl-1,3-thiazol-5-yl]propanoic acid.
| Compound Name | 3-[2-(4-chloro-3-nitroanilino)-4-methyl-1,3-thiazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 82162000 |
| Molecular Formula | C13H12ClN3O4S |
| Molecular Weight | 341.78 g/mol |
| Exact Mass | 341.02 |
| IUPAC Name | 3-[2-(4-chloro-3-nitroanilino)-4-methyl-1,3-thiazol-5-yl]propanoic acid |
| SMILES | Cc1nc(Nc2ccc(Cl)c([N+](=O)[O-])c2)sc1CCC(=O)O |
| InChI | InChI=1S/C13H12ClN3O4S/c1-7-11(4-5-12(18)19)22-13(15-7)16-8-2-3-9(14)10(6-8)17(20)21/h2-3,6H,4-5H2,1H3,(H,15,16)(H,18,19) |
| InChIKey | HIBFQQLZZXJRQI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 105.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.78 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|