C8H7N3O3 — CID 82171064
5-amino-2-(furan-2-yl)-1H-pyrimidine-4,6-dione (PubChem CID 82171064) has the molecular formula C8H7N3O3 and a molecular weight of 193.16 g/mol. Its IUPAC name is 5-amino-2-(furan-2-yl)-1H-pyrimidine-4,6-dione.
| Compound Name | 5-amino-2-(furan-2-yl)-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 82171064 |
| Molecular Formula | C8H7N3O3 |
| Molecular Weight | 193.16 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 5-amino-2-(furan-2-yl)-1H-pyrimidine-4,6-dione |
| SMILES | NC1C(=O)N=C(c2ccco2)NC1=O |
| InChI | InChI=1S/C8H7N3O3/c9-5-7(12)10-6(11-8(5)13)4-2-1-3-14-4/h1-3,5H,9H2,(H,10,11,12,13) |
| InChIKey | ROHGXAIZFOWXPQ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.16 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|