About 3-(furan-2-yl)-5-methyl-2,5-dihydro-1,2,4-oxadiazole
3-(furan-2-yl)-5-methyl-2,5-dihydro-1,2,4-oxadiazole (PubChem CID 10820747) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is 3-(furan-2-yl)-5-methyl-2,5-dihydro-1,2,4-oxadiazole.
Analyze 3-(furan-2-yl)-5-methyl-2,5-dihydro-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(furan-2-yl)-5-methyl-2,5-dihydro-1,2,4-oxadiazole?
The IUPAC name of 3-(furan-2-yl)-5-methyl-2,5-dihydro-1,2,4-oxadiazole (CID 10820747) is 3-(furan-2-yl)-5-methyl-2,5-dihydro-1,2,4-oxadiazole.
What is the SMILES notation for 3-(furan-2-yl)-5-methyl-2,5-dihydro-1,2,4-oxadiazole?
The canonical SMILES for 3-(furan-2-yl)-5-methyl-2,5-dihydro-1,2,4-oxadiazole is CC1N=C(c2ccco2)NO1.
What is the InChIKey of 3-(furan-2-yl)-5-methyl-2,5-dihydro-1,2,4-oxadiazole?
The InChIKey is UYBMYBQVHQLWGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c1-5-8-7(9-11-5)6-3-2-4-10-6/h2-5H,1H3,(H,8,9).
What are the key properties of 3-(furan-2-yl)-5-methyl-2,5-dihydro-1,2,4-oxadiazole?
3-(furan-2-yl)-5-methyl-2,5-dihydro-1,2,4-oxadiazole has a molecular weight of 152.15 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(furan-2-yl)-5-methyl-2,5-dihydro-1,2,4-oxadiazole is sourced from PubChem (CID 10820747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).