C8H8N2O — CID 129140568
2-(furan-2-yl)-1,4-dihydropyrimidine (PubChem CID 129140568) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 2-(furan-2-yl)-1,4-dihydropyrimidine.
| Compound Name | 2-(furan-2-yl)-1,4-dihydropyrimidine |
|---|---|
| PubChem CID | 129140568 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 2-(furan-2-yl)-1,4-dihydropyrimidine |
| SMILES | C1=CNC(c2ccco2)=NC1 |
| InChI | InChI=1S/C8H8N2O/c1-3-7(11-6-1)8-9-4-2-5-10-8/h1-4,6H,5H2,(H,9,10) |
| InChIKey | CIKCFROASAPUAJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 37.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |