C12H14N2O3S2 — CID 82182158
4-[[2-(3-amino-3-sulfanylidenepropyl)sulfanylacetyl]amino]benzoic acid (PubChem CID 82182158) has the molecular formula C12H14N2O3S2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 4-[[2-(3-amino-3-sulfanylidenepropyl)sulfanylacetyl]amino]benzoic acid.
| Compound Name | 4-[[2-(3-amino-3-sulfanylidenepropyl)sulfanylacetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 82182158 |
| Molecular Formula | C12H14N2O3S2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | 4-[[2-(3-amino-3-sulfanylidenepropyl)sulfanylacetyl]amino]benzoic acid |
| SMILES | NC(=S)CCSCC(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C12H14N2O3S2/c13-10(18)5-6-19-7-11(15)14-9-3-1-8(2-4-9)12(16)17/h1-4H,5-7H2,(H2,13,18)(H,14,15)(H,16,17) |
| InChIKey | ODIGKZJHMISMHM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|