C15H25N3O3S — CID 82355141
N-(3-aminopropyl)-4-methyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide (PubChem CID 82355141) has the molecular formula C15H25N3O3S and a molecular weight of 327.45 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-methyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide.
| Compound Name | N-(3-aminopropyl)-4-methyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide |
|---|---|
| PubChem CID | 82355141 |
| Molecular Formula | C15H25N3O3S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | N-(3-aminopropyl)-4-methyl-2-propan-2-yl-2,3-dihydro-1,4-benzoxazine-6-sulfonamide |
| SMILES | CC(C)C1CN(C)c2cc(S(=O)(=O)NCCCN)ccc2O1 |
| InChI | InChI=1S/C15H25N3O3S/c1-11(2)15-10-18(3)13-9-12(5-6-14(13)21-15)22(19,20)17-8-4-7-16/h5-6,9,11,15,17H,4,7-8,10,16H2,1-3H3 |
| InChIKey | OJWKIZDCBPUCMH-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|