C16H27N3O4S2 — CID 119962294
N-(3-aminopropyl)-4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzenesulfonamide (PubChem CID 119962294) has the molecular formula C16H27N3O4S2 and a molecular weight of 389.54 g/mol. Its IUPAC name is N-(3-aminopropyl)-4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzenesulfonamide.
| Compound Name | N-(3-aminopropyl)-4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 119962294 |
| Molecular Formula | C16H27N3O4S2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | N-(3-aminopropyl)-4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzenesulfonamide |
| SMILES | CC1CC(C)CN(S(=O)(=O)c2ccc(S(=O)(=O)NCCCN)cc2)C1 |
| InChI | InChI=1S/C16H27N3O4S2/c1-13-10-14(2)12-19(11-13)25(22,23)16-6-4-15(5-7-16)24(20,21)18-9-3-8-17/h4-7,13-14,18H,3,8-12,17H2,1-2H3 |
| InChIKey | ZYNUONGIQXHFCX-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|