C8H14N2O2 — CID 82412434
2-amino-3-methyl-1-(1,3-oxazol-5-yl)butan-1-ol (PubChem CID 82412434) has the molecular formula C8H14N2O2 and a molecular weight of 170.21 g/mol. Its IUPAC name is 2-amino-3-methyl-1-(1,3-oxazol-5-yl)butan-1-ol.
| Compound Name | 2-amino-3-methyl-1-(1,3-oxazol-5-yl)butan-1-ol |
|---|---|
| PubChem CID | 82412434 |
| Molecular Formula | C8H14N2O2 |
| Molecular Weight | 170.21 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | 2-amino-3-methyl-1-(1,3-oxazol-5-yl)butan-1-ol |
| SMILES | CC(C)C(N)C(O)c1cnco1 |
| InChI | InChI=1S/C8H14N2O2/c1-5(2)7(9)8(11)6-3-10-4-12-6/h3-5,7-8,11H,9H2,1-2H3 |
| InChIKey | XKVPQCFJCDJOFG-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.21 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |