About N,N-dimethyl-1-(1,3-oxazol-5-yl)propane-1,3-diamine
N,N-dimethyl-1-(1,3-oxazol-5-yl)propane-1,3-diamine (PubChem CID 82412757) has the molecular formula C8H15N3O
and a molecular weight of 169.23 g/mol. Its IUPAC name is N,N-dimethyl-1-(1,3-oxazol-5-yl)propane-1,3-diamine.
Analyze N,N-dimethyl-1-(1,3-oxazol-5-yl)propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dimethyl-1-(1,3-oxazol-5-yl)propane-1,3-diamine?
The IUPAC name of N,N-dimethyl-1-(1,3-oxazol-5-yl)propane-1,3-diamine (CID 82412757) is N,N-dimethyl-1-(1,3-oxazol-5-yl)propane-1,3-diamine.
What is the SMILES notation for N,N-dimethyl-1-(1,3-oxazol-5-yl)propane-1,3-diamine?
The canonical SMILES for N,N-dimethyl-1-(1,3-oxazol-5-yl)propane-1,3-diamine is CN(C)C(CCN)c1cnco1.
What is the InChIKey of N,N-dimethyl-1-(1,3-oxazol-5-yl)propane-1,3-diamine?
The InChIKey is TUJVMSCFVSHKFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15N3O/c1-11(2)7(3-4-9)8-5-10-6-12-8/h5-7H,3-4,9H2,1-2H3.
What are the key properties of N,N-dimethyl-1-(1,3-oxazol-5-yl)propane-1,3-diamine?
N,N-dimethyl-1-(1,3-oxazol-5-yl)propane-1,3-diamine has a molecular weight of 169.23 g/mol, XLogP of 0.63, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dimethyl-1-(1,3-oxazol-5-yl)propane-1,3-diamine is sourced from PubChem (CID 82412757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).