C10H12N4O2S2 — CID 82424818
5-[2-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82424818) has the molecular formula C10H12N4O2S2 and a molecular weight of 284.37 g/mol. Its IUPAC name is 5-[2-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82424818 |
| Molecular Formula | C10H12N4O2S2 |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 5-[2-(morpholin-4-ylmethyl)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | S=c1[nH]nc(-c2cnc(CN3CCOCC3)s2)o1 |
| InChI | InChI=1S/C10H12N4O2S2/c17-10-13-12-9(16-10)7-5-11-8(18-7)6-14-1-3-15-4-2-14/h5H,1-4,6H2,(H,13,17) |
| InChIKey | CTIBGRDTCNNIAI-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 67.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|