C7H8N4OS2 — CID 82425188
5-[2-(dimethylamino)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione (PubChem CID 82425188) has the molecular formula C7H8N4OS2 and a molecular weight of 228.30 g/mol. Its IUPAC name is 5-[2-(dimethylamino)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione.
| Compound Name | 5-[2-(dimethylamino)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
|---|---|
| PubChem CID | 82425188 |
| Molecular Formula | C7H8N4OS2 |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.01 |
| IUPAC Name | 5-[2-(dimethylamino)-1,3-thiazol-5-yl]-3H-1,3,4-oxadiazole-2-thione |
| SMILES | CN(C)c1ncc(-c2n[nH]c(=S)o2)s1 |
| InChI | InChI=1S/C7H8N4OS2/c1-11(2)6-8-3-4(14-6)5-9-10-7(13)12-5/h3H,1-2H3,(H,10,13) |
| InChIKey | RWHNFRFEQWVPSN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|