C9H15N3 — CID 82502911
4-(3-aminopropyl)benzene-1,2-diamine (PubChem CID 82502911) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 4-(3-aminopropyl)benzene-1,2-diamine.
| Compound Name | 4-(3-aminopropyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 82502911 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 4-(3-aminopropyl)benzene-1,2-diamine |
| SMILES | NCCCc1ccc(N)c(N)c1 |
| InChI | InChI=1S/C9H15N3/c10-5-1-2-7-3-4-8(11)9(12)6-7/h3-4,6H,1-2,5,10-12H2 |
| InChIKey | CUKLVMYKNVTNCL-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|