C9H12FN3O2S — CID 82513571
3-fluoro-4-(5-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)aniline (PubChem CID 82513571) has the molecular formula C9H12FN3O2S and a molecular weight of 245.28 g/mol. Its IUPAC name is 3-fluoro-4-(5-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)aniline.
| Compound Name | 3-fluoro-4-(5-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)aniline |
|---|---|
| PubChem CID | 82513571 |
| Molecular Formula | C9H12FN3O2S |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.06 |
| IUPAC Name | 3-fluoro-4-(5-methyl-1,1-dioxo-1,2,5-thiadiazolidin-2-yl)aniline |
| SMILES | CN1CCN(c2ccc(N)cc2F)S1(=O)=O |
| InChI | InChI=1S/C9H12FN3O2S/c1-12-4-5-13(16(12,14)15)9-3-2-7(11)6-8(9)10/h2-3,6H,4-5,11H2,1H3 |
| InChIKey | OBHVRECFLQHRPC-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|