C11H17N3O2S — CID 117015676
5-ethyl-2-methyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-amine (PubChem CID 117015676) has the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. Its IUPAC name is 5-ethyl-2-methyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-amine.
| Compound Name | 5-ethyl-2-methyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-amine |
|---|---|
| PubChem CID | 117015676 |
| Molecular Formula | C11H17N3O2S |
| Molecular Weight | 255.34 g/mol |
| Exact Mass | 255.10 |
| IUPAC Name | 5-ethyl-2-methyl-1,1-dioxo-3,4-dihydro-1λ6,2,5-benzothiadiazepin-8-amine |
| SMILES | CCN1CCN(C)S(=O)(=O)c2cc(N)ccc21 |
| InChI | InChI=1S/C11H17N3O2S/c1-3-14-7-6-13(2)17(15,16)11-8-9(12)4-5-10(11)14/h4-5,8H,3,6-7,12H2,1-2H3 |
| InChIKey | RYKHFXDEECKCFR-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.34 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|