C11H12BrN3 — CID 82572186
4-bromo-1-N,8-dimethylisoquinoline-1,5-diamine (PubChem CID 82572186) has the molecular formula C11H12BrN3 and a molecular weight of 266.14 g/mol. Its IUPAC name is 4-bromo-1-N,8-dimethylisoquinoline-1,5-diamine.
| Compound Name | 4-bromo-1-N,8-dimethylisoquinoline-1,5-diamine |
|---|---|
| PubChem CID | 82572186 |
| Molecular Formula | C11H12BrN3 |
| Molecular Weight | 266.14 g/mol |
| Exact Mass | 265.02 |
| IUPAC Name | 4-bromo-1-N,8-dimethylisoquinoline-1,5-diamine |
| SMILES | CNc1ncc(Br)c2c(N)ccc(C)c12 |
| InChI | InChI=1S/C11H12BrN3/c1-6-3-4-8(13)10-7(12)5-15-11(14-2)9(6)10/h3-5H,13H2,1-2H3,(H,14,15) |
| InChIKey | WXCADVLCRSNTRA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.14 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|