C13H16ClNO6 — CID 82813821
(2S)-2-[(5-chlorofuran-2-carbonyl)amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (PubChem CID 82813821) has the molecular formula C13H16ClNO6 and a molecular weight of 317.73 g/mol. Its IUPAC name is (2S)-2-[(5-chlorofuran-2-carbonyl)amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid.
| Compound Name | (2S)-2-[(5-chlorofuran-2-carbonyl)amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 82813821 |
| Molecular Formula | C13H16ClNO6 |
| Molecular Weight | 317.73 g/mol |
| Exact Mass | 317.07 |
| IUPAC Name | (2S)-2-[(5-chlorofuran-2-carbonyl)amino]-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| SMILES | CC(C)(C)OC(=O)C[C@H](NC(=O)c1ccc(Cl)o1)C(=O)O |
| InChI | InChI=1S/C13H16ClNO6/c1-13(2,3)21-10(16)6-7(12(18)19)15-11(17)8-4-5-9(14)20-8/h4-5,7H,6H2,1-3H3,(H,15,17)(H,18,19)/t7-/m0/s1 |
| InChIKey | AXZOSMVRXDGFNI-ZETCQYMHSA-N |
| XLogP | 1.85 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.73 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |