About 2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene
2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene (PubChem CID 82822177) has the molecular formula C11H13BrF2
and a molecular weight of 263.12 g/mol. Its IUPAC name is 2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene.
Molecular Properties
| Compound Name | 2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene |
| PubChem CID | 82822177 |
| Molecular Formula | C11H13BrF2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | 2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene |
| SMILES | Cc1ccc(F)c(CCC(C)Br)c1F |
| InChI | InChI=1S/C11H13BrF2/c1-7-3-6-10(13)9(11(7)14)5-4-8(2)12/h3,6,8H,4-5H2,1-2H3 |
| InChIKey | MRJSSTBEGAEVLR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene?
The IUPAC name of 2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene (CID 82822177) is 2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene.
What is the SMILES notation for 2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene?
The canonical SMILES for 2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene is Cc1ccc(F)c(CCC(C)Br)c1F.
What is the InChIKey of 2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene?
The InChIKey is MRJSSTBEGAEVLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13BrF2/c1-7-3-6-10(13)9(11(7)14)5-4-8(2)12/h3,6,8H,4-5H2,1-2H3.
What are the key properties of 2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene?
2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene has a molecular weight of 263.12 g/mol, XLogP of 3.99, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-bromobutyl)-1,3-difluoro-4-methylbenzene is sourced from PubChem (CID 82822177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).