C10H20N4O2S — CID 82952969
5-N,5-N-bis(2-ethoxyethyl)-1,2,4-thiadiazole-3,5-diamine (PubChem CID 82952969) has the molecular formula C10H20N4O2S and a molecular weight of 260.36 g/mol. Its IUPAC name is 5-N,5-N-bis(2-ethoxyethyl)-1,2,4-thiadiazole-3,5-diamine.
| Compound Name | 5-N,5-N-bis(2-ethoxyethyl)-1,2,4-thiadiazole-3,5-diamine |
|---|---|
| PubChem CID | 82952969 |
| Molecular Formula | C10H20N4O2S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-N,5-N-bis(2-ethoxyethyl)-1,2,4-thiadiazole-3,5-diamine |
| SMILES | CCOCCN(CCOCC)c1nc(N)ns1 |
| InChI | InChI=1S/C10H20N4O2S/c1-3-15-7-5-14(6-8-16-4-2)10-12-9(11)13-17-10/h3-8H2,1-2H3,(H2,11,13) |
| InChIKey | KYASHDYTSWKXJH-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|