C10H21N5O2 — CID 82952891
3-N,3-N-bis(2-ethoxyethyl)-1H-1,2,4-triazole-3,5-diamine (PubChem CID 82952891) has the molecular formula C10H21N5O2 and a molecular weight of 243.31 g/mol. Its IUPAC name is 3-N,3-N-bis(2-ethoxyethyl)-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N,3-N-bis(2-ethoxyethyl)-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 82952891 |
| Molecular Formula | C10H21N5O2 |
| Molecular Weight | 243.31 g/mol |
| Exact Mass | 243.17 |
| IUPAC Name | 3-N,3-N-bis(2-ethoxyethyl)-1H-1,2,4-triazole-3,5-diamine |
| SMILES | CCOCCN(CCOCC)c1n[nH]c(N)n1 |
| InChI | InChI=1S/C10H21N5O2/c1-3-16-7-5-15(6-8-17-4-2)10-12-9(11)13-14-10/h3-8H2,1-2H3,(H3,11,12,13,14) |
| InChIKey | UOSKMLQLXWEUOB-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 89.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|