C8H16N2O4S — CID 83022353
4-(morpholin-4-ylamino)-1,1-dioxothiolan-3-ol (PubChem CID 83022353) has the molecular formula C8H16N2O4S and a molecular weight of 236.29 g/mol. Its IUPAC name is 4-(morpholin-4-ylamino)-1,1-dioxothiolan-3-ol.
| Compound Name | 4-(morpholin-4-ylamino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 83022353 |
| Molecular Formula | C8H16N2O4S |
| Molecular Weight | 236.29 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 4-(morpholin-4-ylamino)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)CC(O)C(NN2CCOCC2)C1 |
| InChI | InChI=1S/C8H16N2O4S/c11-8-6-15(12,13)5-7(8)9-10-1-3-14-4-2-10/h7-9,11H,1-6H2 |
| InChIKey | XNGLLKBFIUSLEZ-UHFFFAOYSA-N |
| XLogP | -2.02 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.29 |
| LogP ≤ 5 | -2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |