C9H17F3N2O2S2 — CID 83058365
2-(4,4,4-trifluorobutylsulfonylamino)pentanethioamide (PubChem CID 83058365) has the molecular formula C9H17F3N2O2S2 and a molecular weight of 306.38 g/mol. Its IUPAC name is 2-(4,4,4-trifluorobutylsulfonylamino)pentanethioamide.
| Compound Name | 2-(4,4,4-trifluorobutylsulfonylamino)pentanethioamide |
|---|---|
| PubChem CID | 83058365 |
| Molecular Formula | C9H17F3N2O2S2 |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 2-(4,4,4-trifluorobutylsulfonylamino)pentanethioamide |
| SMILES | CCCC(NS(=O)(=O)CCCC(F)(F)F)C(N)=S |
| InChI | InChI=1S/C9H17F3N2O2S2/c1-2-4-7(8(13)17)14-18(15,16)6-3-5-9(10,11)12/h7,14H,2-6H2,1H3,(H2,13,17) |
| InChIKey | KHAZAMINRMSOON-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|