C7H5Cl2FN2O — CID 83079264
(2,6-dichloro-4-fluorophenyl)urea (PubChem CID 83079264) has the molecular formula C7H5Cl2FN2O and a molecular weight of 223.03 g/mol. Its IUPAC name is (2,6-dichloro-4-fluorophenyl)urea.
| Compound Name | (2,6-dichloro-4-fluorophenyl)urea |
|---|---|
| PubChem CID | 83079264 |
| Molecular Formula | C7H5Cl2FN2O |
| Molecular Weight | 223.03 g/mol |
| Exact Mass | 221.98 |
| IUPAC Name | (2,6-dichloro-4-fluorophenyl)urea |
| SMILES | NC(=O)Nc1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C7H5Cl2FN2O/c8-4-1-3(10)2-5(9)6(4)12-7(11)13/h1-2H,(H3,11,12,13) |
| InChIKey | VIIKNCGOCNLBLC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.03 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |