C8H17N5O2S — CID 83082650
[1-(2-methoxyethylamino)-1-oxopropan-2-yl] N-(diaminomethylidene)carbamimidothioate (PubChem CID 83082650) has the molecular formula C8H17N5O2S and a molecular weight of 247.32 g/mol. Its IUPAC name is [1-(2-methoxyethylamino)-1-oxopropan-2-yl] N-(diaminomethylidene)carbamimidothioate.
| Compound Name | [1-(2-methoxyethylamino)-1-oxopropan-2-yl] N-(diaminomethylidene)carbamimidothioate |
|---|---|
| PubChem CID | 83082650 |
| Molecular Formula | C8H17N5O2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | [1-(2-methoxyethylamino)-1-oxopropan-2-yl] N-(diaminomethylidene)carbamimidothioate |
| SMILES | [H]/N=C(\N=C(N)N)SC(C)C(=O)NCCOC |
| InChI | InChI=1S/C8H17N5O2S/c1-5(6(14)12-3-4-15-2)16-8(11)13-7(9)10/h5H,3-4H2,1-2H3,(H,12,14)(H5,9,10,11,13) |
| InChIKey | FDAQQYYFLJZCOK-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 126.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|