C11H25N3O2 — CID 83116380
3-[2-[(1-methoxy-3-methylbutan-2-yl)amino]ethyl]-1,1-dimethylurea (PubChem CID 83116380) has the molecular formula C11H25N3O2 and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-[2-[(1-methoxy-3-methylbutan-2-yl)amino]ethyl]-1,1-dimethylurea.
| Compound Name | 3-[2-[(1-methoxy-3-methylbutan-2-yl)amino]ethyl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 83116380 |
| Molecular Formula | C11H25N3O2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.19 |
| IUPAC Name | 3-[2-[(1-methoxy-3-methylbutan-2-yl)amino]ethyl]-1,1-dimethylurea |
| SMILES | COCC(NCCNC(=O)N(C)C)C(C)C |
| InChI | InChI=1S/C11H25N3O2/c1-9(2)10(8-16-5)12-6-7-13-11(15)14(3)4/h9-10,12H,6-8H2,1-5H3,(H,13,15) |
| InChIKey | LWNYKMUBFUEEMQ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|