C13H20Cl2N2 — CID 83142233
4,5-dichloro-2-N-(2,3,3-trimethylbutyl)benzene-1,2-diamine (PubChem CID 83142233) has the molecular formula C13H20Cl2N2 and a molecular weight of 275.22 g/mol. Its IUPAC name is 4,5-dichloro-2-N-(2,3,3-trimethylbutyl)benzene-1,2-diamine.
| Compound Name | 4,5-dichloro-2-N-(2,3,3-trimethylbutyl)benzene-1,2-diamine |
|---|---|
| PubChem CID | 83142233 |
| Molecular Formula | C13H20Cl2N2 |
| Molecular Weight | 275.22 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 4,5-dichloro-2-N-(2,3,3-trimethylbutyl)benzene-1,2-diamine |
| SMILES | CC(CNc1cc(Cl)c(Cl)cc1N)C(C)(C)C |
| InChI | InChI=1S/C13H20Cl2N2/c1-8(13(2,3)4)7-17-12-6-10(15)9(14)5-11(12)16/h5-6,8,17H,7,16H2,1-4H3 |
| InChIKey | APZDAXSNWLIEHI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.22 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|