C10H18O2S2 — CID 83381402
3-cyclohexylsulfanylthiolane 1,1-dioxide (PubChem CID 83381402) has the molecular formula C10H18O2S2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 3-cyclohexylsulfanylthiolane 1,1-dioxide.
| Compound Name | 3-cyclohexylsulfanylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 83381402 |
| Molecular Formula | C10H18O2S2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 3-cyclohexylsulfanylthiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(SC2CCCCC2)C1 |
| InChI | InChI=1S/C10H18O2S2/c11-14(12)7-6-10(8-14)13-9-4-2-1-3-5-9/h9-10H,1-8H2 |
| InChIKey | FKQZNSWBYXAFPX-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |