C7H12N4 — CID 83864203
5-N-cyclopropyl-3-N-methyl-1H-pyrazole-3,5-diamine (PubChem CID 83864203) has the molecular formula C7H12N4 and a molecular weight of 152.20 g/mol. Its IUPAC name is 5-N-cyclopropyl-3-N-methyl-1H-pyrazole-3,5-diamine.
| Compound Name | 5-N-cyclopropyl-3-N-methyl-1H-pyrazole-3,5-diamine |
|---|---|
| PubChem CID | 83864203 |
| Molecular Formula | C7H12N4 |
| Molecular Weight | 152.20 g/mol |
| Exact Mass | 152.11 |
| IUPAC Name | 5-N-cyclopropyl-3-N-methyl-1H-pyrazole-3,5-diamine |
| SMILES | CNc1cc(NC2CC2)[nH]n1 |
| InChI | InChI=1S/C7H12N4/c1-8-6-4-7(11-10-6)9-5-2-3-5/h4-5H,2-3H2,1H3,(H3,8,9,10,11) |
| InChIKey | MUYHIDLRPVKJPJ-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 52.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |