C9H11N3OS — CID 83871725
6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-4-carbaldehyde (PubChem CID 83871725) has the molecular formula C9H11N3OS and a molecular weight of 209.27 g/mol. Its IUPAC name is 6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-4-carbaldehyde.
| Compound Name | 6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-4-carbaldehyde |
|---|---|
| PubChem CID | 83871725 |
| Molecular Formula | C9H11N3OS |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.06 |
| IUPAC Name | 6-methyl-2-methylsulfanyl-5,7-dihydropyrrolo[3,4-d]pyrimidine-4-carbaldehyde |
| SMILES | CSc1nc(C=O)c2c(n1)CN(C)C2 |
| InChI | InChI=1S/C9H11N3OS/c1-12-3-6-7(4-12)10-9(14-2)11-8(6)5-13/h5H,3-4H2,1-2H3 |
| InChIKey | SSSLWHYMKSRZJI-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|